EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N3O2S |
| Net Charge | 0 |
| Average Mass | 249.295 |
| Monoisotopic Mass | 249.05720 |
| SMILES | CCOC(=O)c1csc(Nc2ccncc2)n1 |
| InChI | InChI=1S/C11H11N3O2S/c1-2-16-10(15)9-7-17-11(14-9)13-8-3-5-12-6-4-8/h3-7H,2H2,1H3,(H,12,13,14) |
| InChIKey | UIMHAGZRGWCTHY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 2-(pyridin-4-ylamino)-1,3-thiazole-4-carboxylate (CHEBI:228729) is a aromatic carboxylic acid (CHEBI:33859) |
| ethyl 2-(pyridin-4-ylamino)-1,3-thiazole-4-carboxylate (CHEBI:228729) is a thiazoles (CHEBI:48901) |
| IUPAC Name |
|---|
| ethyl 2-(pyridin-4-ylamino)-1,3-thiazole-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2023616 | ChemSpider |