EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14O4 |
| Net Charge | 0 |
| Average Mass | 342.350 |
| Monoisotopic Mass | 342.08921 |
| SMILES | O=C(O)c1cccc2cccc(-c3cccc4cccc(C(=O)O)c34)c12 |
| InChI | InChI=1S/C22H14O4/c23-21(24)17-11-3-7-13-5-1-9-15(19(13)17)16-10-2-6-14-8-4-12-18(20(14)16)22(25)26/h1-12H,(H,23,24)(H,25,26) |
| InChIKey | XGDAODQNSVFBGM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,8'-dicarboxy-1,1'-binaphthalene (CHEBI:228723) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 8-(8-carboxynaphthalen-1-yl)naphthalene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 85633 | ChemSpider |