EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N3O3 |
| Net Charge | 0 |
| Average Mass | 197.194 |
| Monoisotopic Mass | 197.08004 |
| SMILES | O=c1ncc(N2CCOCC2)c(=O)n1 |
| InChI | InChI=1S/C8H11N3O3/c12-7-6(5-9-8(13)10-7)11-1-3-14-4-2-11/h5H,1-4H2,(H2,9,10,12,13) |
| InChIKey | SIVJYKAWVLZRSX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-morpholino-2,4(1H,3H)-pyrimidinedione (CHEBI:228718) is a dialkylarylamine (CHEBI:23665) |
| 5-morpholino-2,4(1H,3H)-pyrimidinedione (CHEBI:228718) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5-morpholin-4-yl-1H-pyrimidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 599251 | ChemSpider |