EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N6 |
| Net Charge | 0 |
| Average Mass | 216.248 |
| Monoisotopic Mass | 216.11234 |
| SMILES | Nc1ncnc2nc(N3CCCC3)ncc12 |
| InChI | InChI=1S/C10H12N6/c11-8-7-5-12-10(16-3-1-2-4-16)15-9(7)14-6-13-8/h5-6H,1-4H2,(H2,11,12,13,14,15) |
| InChIKey | LLENOGXZCZHFBJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) | |
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-(1-pyrrolidinyl)pyrimido[4,5-d]pyrimidin-4-amine (CHEBI:228711) is a dialkylarylamine (CHEBI:23665) |
| 7-(1-pyrrolidinyl)pyrimido[4,5-d]pyrimidin-4-amine (CHEBI:228711) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-pyrrolidin-1-ylpyrimido[4,5-d]pyrimidin-5-amine |
| Manual Xrefs | Databases |
|---|---|
| 2095285 | ChemSpider |