EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O6S |
| Net Charge | 0 |
| Average Mass | 232.213 |
| Monoisotopic Mass | 232.00416 |
| SMILES | COc1c(C(=O)O)sc(C(=O)O)c1OC |
| InChI | InChI=1S/C8H8O6S/c1-13-3-4(14-2)6(8(11)12)15-5(3)7(9)10/h1-2H3,(H,9,10)(H,11,12) |
| InChIKey | VJPALIAORYSTKL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethoxythiophene-2,5-dicarboxylic acid (CHEBI:228704) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| 3,4-dimethoxythiophene-2,5-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2080243 | ChemSpider |