EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 287.146 |
| Monoisotopic Mass | 286.02758 |
| SMILES | N/C(CC1CC1(Cl)Cl)=N\OC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12Cl2N2O2/c13-12(14)7-9(12)6-10(15)16-18-11(17)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,15,16) |
| InChIKey | ICAXSMQUIXVHPP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'-(benzoyloxy)-2-(2,2-dichlorocyclopropyl)ethanimidamide (CHEBI:228701) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| [(Z)-[1-amino-2-(2,2-dichlorocyclopropyl)ethylidene]amino] benzoate |
| Manual Xrefs | Databases |
|---|---|
| 2084278 | ChemSpider |