EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11ClN2O2 |
| Net Charge | 0 |
| Average Mass | 298.729 |
| Monoisotopic Mass | 298.05091 |
| SMILES | Clc1ccc2c(Nc3ccc4c(c3)OCO4)ccnc2c1 |
| InChI | InChI=1S/C16H11ClN2O2/c17-10-1-3-12-13(5-6-18-14(12)7-10)19-11-2-4-15-16(8-11)21-9-20-15/h1-8H,9H2,(H,18,19) |
| InChIKey | UWSPBYIZLDIQHB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(1,3-benzodioxol-5-yl)-7-chloroquinolin-4-amine (CHEBI:228699) is a aminoquinoline (CHEBI:36709) |
| IUPAC Name |
|---|
| N-(1,3-benzodioxol-5-yl)-7-chloroquinolin-4-amine |
| Manual Xrefs | Databases |
|---|---|
| 2101915 | ChemSpider |