EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N4O |
| Net Charge | 0 |
| Average Mass | 366.509 |
| Monoisotopic Mass | 366.24196 |
| SMILES | CC(C)CCNc1ncccc1C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N4O/c1-18(2)10-12-24-21-20(9-6-11-23-21)22(27)26-15-13-25(14-16-26)17-19-7-4-3-5-8-19/h3-9,11,18H,10,12-17H2,1-2H3,(H,23,24) |
| InChIKey | DYTOQURYRYYNOR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NSI-189 (CHEBI:228696) is a aromatic carboxylic acid (CHEBI:33859) |
| NSI-189 (CHEBI:228696) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| IUPAC Name |
|---|
| (4-benzylpiperazin-1-yl)-[2-(3-methylbutylamino)pyridin-3-yl]methanone |