EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O4S |
| Net Charge | 0 |
| Average Mass | 284.337 |
| Monoisotopic Mass | 284.08308 |
| SMILES | CCOC(=O)C1CCN(c2sccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16N2O4S/c1-2-18-12(15)9-3-6-13(7-4-9)11-10(14(16)17)5-8-19-11/h5,8-9H,2-4,6-7H2,1H3 |
| InChIKey | JZSLPTWXOQPUFB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 1-(3-nitro-2-thienyl)piperidine-4-carboxylate (CHEBI:228669) is a carboxylic acid (CHEBI:33575) |
| ethyl 1-(3-nitro-2-thienyl)piperidine-4-carboxylate (CHEBI:228669) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| ethyl 1-(3-nitrothiophen-2-yl)piperidine-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2101378 | ChemSpider |