EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N7O6S |
| Net Charge | +1 |
| Average Mass | 630.792 |
| Monoisotopic Mass | 630.30683 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)N=[N+]=N)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccc(CN)cc1)[C@@H](O)CS(C)(=O)=O |
| InChI | InChI=1S/C30H43N7O6S/c1-19(2)14-25(35-30(41)26(36-37-32)16-21-8-6-5-7-9-21)29(40)33-20(3)28(39)34-24(27(38)18-44(4,42)43)15-22-10-12-23(17-31)13-11-22/h5-13,19-20,24-27,32,38H,14-18,31H2,1-4H3,(H2-,33,34,35,39,40,41)/p+1/t20-,24-,25-,26-,27-/m0/s1 |
| InChIKey | RCRPLXMWHFJRLV-KKASSDGMSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GQH (CHEBI:228651) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S,3R)-1-[4-(aminomethyl)phenyl]-3-hydroxy-4-methylsulonylbutan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]imino-iminoazanium |