EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26Cl2N2O |
| Net Charge | 0 |
| Average Mass | 429.391 |
| Monoisotopic Mass | 428.14222 |
| SMILES | CN(C)c1ccc(C=C2CCCC(=Cc3ccc(N(C)C)cc3Cl)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C24H26Cl2N2O/c1-27(2)20-10-8-16(22(25)14-20)12-18-6-5-7-19(24(18)29)13-17-9-11-21(28(3)4)15-23(17)26/h8-15H,5-7H2,1-4H3 |
| InChIKey | JYXJLAFLYANCKO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-di[2-chloro-4-(dimethylamino)benzylidene]cyclohexan-1-one (CHEBI:228640) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 2,6-bis[[2-chloro-4-(dimethylamino)phenyl]methylidene]cyclohexan-1-one |
| Manual Xrefs | Databases |
|---|---|
| 2085067 | ChemSpider |