EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO5 |
| Net Charge | 0 |
| Average Mass | 333.384 |
| Monoisotopic Mass | 333.15762 |
| SMILES | [H][C@@]12Oc3c(OC)ccc4c3[C@@]13CC[N@+](C)([O-])[C@]([H])(C4)[C@]3(O)CC[C@@H]2O |
| InChI | InChI=1S/C18H23NO5/c1-19(22)8-7-17-14-10-3-4-12(23-2)15(14)24-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,11,13,16,20-21H,5-9H2,1-2H3/t11-,13+,16-,17-,18+,19-/m0/s1 |
| InChIKey | PYNMSKPCGNAJAM-XLODQLQYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6alpha-Oxycodol N-oxide (CHEBI:228636) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (3S,4R,4aS,7S,7aR,12bS)-9-methoxy-3-methyl-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinolin-3-ium-4a,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 68003959 | ChemSpider |