EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO5 |
| Net Charge | 0 |
| Average Mass | 315.325 |
| Monoisotopic Mass | 315.11067 |
| SMILES | COCCOc1ccc(/N=C/c2ccccc2O)cc1C(=O)O |
| InChI | InChI=1S/C17H17NO5/c1-22-8-9-23-16-7-6-13(10-14(16)17(20)21)18-11-12-4-2-3-5-15(12)19/h2-7,10-11,19H,8-9H2,1H3,(H,20,21)/b18-11+ |
| InChIKey | RIMVWHPNRMOADG-WOJGMQOQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(2-hydroxybenzylidene)amino]-2-(2-methoxyethoxy)benzoic acid (CHEBI:228577) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 5-[(2-hydroxyphenyl)methylideneamino]-2-(2-methoxyethoxy)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 26461868 | ChemSpider |