EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228561 - DPK
| Formula | C13H19N |
| Net Charge | 0 |
| Average Mass | 189.302 |
| Monoisotopic Mass | 189.15175 |
| SMILES | C=CCN(C)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C13H19N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h4-9,12H,1,10-11H2,2-3H3/t12-/m1/s1 |
| InChIKey | BVYBGDRWIWQPOV-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DPK (CHEBI:228561) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (2R)-N-methyl-1-phenyl-N-prop-2-enylpropan-2-amine |