EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N3 |
| Net Charge | 0 |
| Average Mass | 319.452 |
| Monoisotopic Mass | 319.20485 |
| SMILES | [H][C@]1(c2nc3ccccc3n2C)CCN(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H25N3/c1-23-20-12-6-5-11-19(20)22-21(23)18-13-15-24(16-18)14-7-10-17-8-3-2-4-9-17/h2-6,8-9,11-12,18H,7,10,13-16H2,1H3/t18-/m0/s1 |
| InChIKey | YEHHVSPRHHRKMP-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Methyl-2-[(3S)-1-(3-phenylpropyl)-3-pyrrolidinyl]-1H-benzimidazole (CHEBI:228549) is a amine (CHEBI:32952) |
| IUPAC Name |
|---|
| 1-methyl-2-[(3S)-1-(3-phenylpropyl)pyrrolidin-3-yl]benzimidazole |
| Manual Xrefs | Databases |
|---|---|
| 29850816 | ChemSpider |