EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228534 - 4-(4-methylbenzyl)-1lambda~6~,4-thiazinane-1,1-dione
| Formula | C12H17NO2S |
| Net Charge | 0 |
| Average Mass | 239.340 |
| Monoisotopic Mass | 239.09800 |
| SMILES | Cc1ccc(CN2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C12H17NO2S/c1-11-2-4-12(5-3-11)10-13-6-8-16(14,15)9-7-13/h2-5H,6-10H2,1H3 |
| InChIKey | PBEMXBVPRZGFNM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(4-methylbenzyl)-1lambda~6~,4-thiazinane-1,1-dione (CHEBI:228534) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| 4-[(4-methylphenyl)methyl]-1,4-thiazinane 1,1-dioxide |