EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O2 |
| Net Charge | 0 |
| Average Mass | 282.383 |
| Monoisotopic Mass | 282.16198 |
| SMILES | O=C(CCc1ccccc1)C[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C19H22O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-10,18,20H,11-15H2/t18-/m0/s1 |
| InChIKey | CCNKTMMNRPJQHV-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) | |
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S)-5-hydroxy-1,7-diphenylheptan-3-one (CHEBI:228530) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (5S)-5-hydroxy-1,7-diphenylheptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 8441287 | ChemSpider |