EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClN3OS |
| Net Charge | 0 |
| Average Mass | 305.790 |
| Monoisotopic Mass | 305.03896 |
| SMILES | N#Cc1c(N2CCOCC2)nsc1-c1ccccc1Cl |
| InChI | InChI=1S/C14H12ClN3OS/c15-12-4-2-1-3-10(12)13-11(9-16)14(17-20-13)18-5-7-19-8-6-18/h1-4H,5-8H2 |
| InChIKey | XRXRGTCIAHHONR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(2-chlorophenyl)-3-morpholinoisothiazole-4-carbonitrile (CHEBI:228498) is a dialkylarylamine (CHEBI:23665) |
| 5-(2-chlorophenyl)-3-morpholinoisothiazole-4-carbonitrile (CHEBI:228498) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5-(2-chlorophenyl)-3-morpholin-4-yl-1,2-thiazole-4-carbonitrile |
| Manual Xrefs | Databases |
|---|---|
| 2102667 | ChemSpider |