EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228494 - 4-chloro-N~1~-(4-pyridinyl)-1,2-benzenediamine
| Formula | C11H10ClN3 |
| Net Charge | 0 |
| Average Mass | 219.675 |
| Monoisotopic Mass | 219.05632 |
| SMILES | Nc1cc(Cl)ccc1Nc1ccncc1 |
| InChI | InChI=1S/C11H10ClN3/c12-8-1-2-11(10(13)7-8)15-9-3-5-14-6-4-9/h1-7H,13H2,(H,14,15) |
| InChIKey | LSMXFIQZRFSQBH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-N~1~-(4-pyridinyl)-1,2-benzenediamine (CHEBI:228494) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-chloro-1-N-pyridin-4-ylbenzene-1,2-diamine |