EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10N4O3 |
| Net Charge | 0 |
| Average Mass | 282.259 |
| Monoisotopic Mass | 282.07529 |
| SMILES | N#Cc1cccnc1NNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H10N4O3/c15-8-9-4-3-7-16-12(9)17-18-13(19)10-5-1-2-6-11(10)14(20)21/h1-7H,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | UQQPNJMBAFXSLH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[2-(3-cyano-2-pyridinyl)hydrazino]carbonyl}benzoic acid (CHEBI:228492) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 2-[[(3-cyanopyridin-2-yl)amino]carbamoyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2090491 | ChemSpider |