EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O3 |
| Net Charge | 0 |
| Average Mass | 234.295 |
| Monoisotopic Mass | 234.12559 |
| SMILES | CC(C)(C)C(O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)13(15)7-5-10-4-6-11-12(8-10)17-9-16-11/h4-8,13,15H,9H2,1-3H3/b7-5+ |
| InChIKey | IBLNKMRFIPWSOY-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stiripentol (CHEBI:228488) has role anticonvulsant (CHEBI:35623) |
| Stiripentol (CHEBI:228488) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| (E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol |
| Synonyms | Source |
|---|---|
| BCX 2600 | ChEMBL |
| BCX-2600 | ChEMBL |
| Stiripentol | ChEMBL |
| Citations |
|---|