EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O2 |
| Net Charge | 0 |
| Average Mass | 250.342 |
| Monoisotopic Mass | 250.16813 |
| SMILES | CC(C)CN[C@H]1[C@H](O)[C@H](O)C[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C14H22N2O2/c1-9(2)7-16-13-11(6-12(17)14(13)18)10-4-3-5-15-8-10/h3-5,8-9,11-14,16-18H,6-7H2,1-2H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | XXUDZODJHREXRS-AAVRWANBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2S,3R,4R)-3-(Isobutylamino)-4-(3-pyridinyl)-1,2-cyclopentanediol (CHEBI:228481) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| (1R,2S,3R,4R)-3-(2-methylpropylamino)-4-pyridin-3-ylcyclopentane-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| 29853036 | ChemSpider |