EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13NO2S |
| Net Charge | 0 |
| Average Mass | 259.330 |
| Monoisotopic Mass | 259.06670 |
| SMILES | CCOC(=O)c1c(N)sc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C14H13NO2S/c1-2-17-14(16)12-11-9-6-4-3-5-8(9)7-10(11)18-13(12)15/h3-6H,2,7,15H2,1H3 |
| InChIKey | XUJFNCKOASSEEU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 2-amino-8H-indeno[2,1-b]thiophene-3-carboxylate (CHEBI:228479) is a aromatic amine (CHEBI:33860) |
| ethyl 2-amino-8H-indeno[2,1-b]thiophene-3-carboxylate (CHEBI:228479) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| ethyl 2-amino-4H-indeno[2,1-b]thiophene-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2104330 | ChemSpider |