EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33FN4O2 |
| Net Charge | 0 |
| Average Mass | 464.585 |
| Monoisotopic Mass | 464.25875 |
| SMILES | CC(=O)C1=NN(c2cc(C)ccc2F)C[C@@]1(CCCN1CCN(C(C)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H33FN4O2/c1-20-10-11-24(28)25(18-20)32-19-27(26(29-32)21(2)33,23-8-5-4-6-9-23)12-7-13-30-14-16-31(17-15-30)22(3)34/h4-6,8-11,18H,7,12-17,19H2,1-3H3/t27-/m0/s1 |
| InChIKey | RYUBEOMELHCHMO-MHZLTWQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MKK (CHEBI:228478) is a benzenes (CHEBI:22712) |
| MKK (CHEBI:228478) is a organic amino compound (CHEBI:50047) |
| IUPAC Name |
|---|
| 1-[(4R)-4-[3-(4-acetylpiperazin-1-yl)propyl]-2-(2-luoro-5-methylphenyl)-4-phenyl-3H-pyrazol-5-yl]ethanone |