EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N2O4 |
| Net Charge | 0 |
| Average Mass | 376.412 |
| Monoisotopic Mass | 376.14231 |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2cccnc2)cc(C(=O)Oc2cccnc2)c1 |
| InChI | InChI=1S/C22H20N2O4/c1-22(2,3)17-11-15(20(25)27-18-6-4-8-23-13-18)10-16(12-17)21(26)28-19-7-5-9-24-14-19/h4-14H,1-3H3 |
| InChIKey | YSWGAOFCBWKMTL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| di(3-pyridyl) 5-(tert-butyl)isophthalate (CHEBI:228444) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| dipyridin-3-yl 5-tert-butylbenzene-1,3-dicarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2079719 | ChemSpider |