EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24N2O3 |
| Net Charge | 0 |
| Average Mass | 412.489 |
| Monoisotopic Mass | 412.17869 |
| SMILES | O=C(CN1CCN(C2c3ccccc3-c3ccccc32)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H24N2O3/c29-23(18-9-10-24-25(15-18)31-17-30-24)16-27-11-13-28(14-12-27)26-21-7-3-1-5-19(21)20-6-2-4-8-22(20)26/h1-10,15,26H,11-14,16-17H2 |
| InChIKey | JDEFSHDRTXLRDO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(1,3-benzodioxol-5-yl)-2-[4-(9H-fluoren-9-yl)piperazino]-1-ethanone (CHEBI:228426) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 1-(1,3-benzodioxol-5-yl)-2-[4-(9H-luoren-9-yl)piperazin-1-yl]ethanone |
| Manual Xrefs | Databases |
|---|---|
| 2093887 | ChemSpider |