EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36N6O4 |
| Net Charge | 0 |
| Average Mass | 460.579 |
| Monoisotopic Mass | 460.27980 |
| SMILES | NCCCCC(NC(=O)C(CCCCN)NC(=O)C(N)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H36N6O4/c24-11-5-3-9-19(22(31)29-20(23(32)33)10-4-6-12-25)28-21(30)17(26)13-15-14-27-18-8-2-1-7-16(15)18/h1-2,7-8,14,17,19-20,27H,3-6,9-13,24-26H2,(H,28,30)(H,29,31)(H,32,33) |
| InChIKey | UUIYFDAWNBSWPG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WKK (CHEBI:228418) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| 6-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16575179 | ChemSpider |