EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO2S |
| Net Charge | 0 |
| Average Mass | 299.395 |
| Monoisotopic Mass | 299.09800 |
| SMILES | COc1ccc(NC=CC(=S)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H17NO2S/c1-19-15-7-3-13(4-8-15)17(21)11-12-18-14-5-9-16(20-2)10-6-14/h3-12,18H,1-2H3 |
| InChIKey | GOYDPJHJXPXFPN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-methoxyanilino)-1-(4-methoxyphenyl)prop-2-ene-1-thione (CHEBI:228415) is a aromatic ether (CHEBI:35618) |
| 3-(4-methoxyanilino)-1-(4-methoxyphenyl)prop-2-ene-1-thione (CHEBI:228415) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3-(4-methoxyanilino)-1-(4-methoxyphenyl)prop-2-ene-1-thione |
| Manual Xrefs | Databases |
|---|---|
| 2103272 | ChemSpider |