EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27NO4 |
| Net Charge | 0 |
| Average Mass | 321.417 |
| Monoisotopic Mass | 321.19401 |
| SMILES | CCCCCCOc1ccc(C(=O)N[C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C18H27NO4/c1-4-5-6-7-12-23-15-10-8-14(9-11-15)17(20)19-16(13(2)3)18(21)22/h8-11,13,16H,4-7,12H2,1-3H3,(H,19,20)(H,21,22)/t16-/m0/s1 |
| InChIKey | ICRSRJPPVADSGE-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| QMH (CHEBI:228410) has functional parent N-benzoylglycine (CHEBI:18089) |
| QMH (CHEBI:228410) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| (2S)-2-[(4-hexoxybenzoyl)amino]-3-methylbutanoic acid |