EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21F3N6O |
| Net Charge | 0 |
| Average Mass | 382.390 |
| Monoisotopic Mass | 382.17289 |
| SMILES | OC[C@H]1CCN1c1nc(-c2cnn(C3CCNCC3)c2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H21F3N6O/c18-17(19,20)15-7-14(23-16(24-15)25-6-3-13(25)10-27)11-8-22-26(9-11)12-1-4-21-5-2-12/h7-9,12-13,21,27H,1-6,10H2/t13-/m1/s1 |
| InChIKey | KXGFTHNEKPQMOG-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WNH (CHEBI:228402) is a dialkylarylamine (CHEBI:23665) |
| WNH (CHEBI:228402) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| [(2R)-1-[4-(1-piperidin-4-ylpyrazol-4-yl)-6-(triluoromethyl)pyrimidin-2-yl]azetidin-2-yl]methanol |