EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2O2 |
| Net Charge | 0 |
| Average Mass | 154.169 |
| Monoisotopic Mass | 154.07423 |
| SMILES | CCCNc1c(N)c(=O)c1=O |
| InChI | InChI=1S/C7H10N2O2/c1-2-3-9-5-4(8)6(10)7(5)11/h9H,2-3,8H2,1H3 |
| InChIKey | BNXSOTNBHPGHGZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-4-(propylamino)cyclobut-3-ene-1,2-dione (CHEBI:228390) is a secondary amine (CHEBI:32863) |
| IUPAC Name |
|---|
| 3-amino-4-(propylamino)cyclobut-3-ene-1,2-dione |
| Manual Xrefs | Databases |
|---|---|
| 2104746 | ChemSpider |