EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30 |
| Net Charge | 0 |
| Average Mass | 270.460 |
| Monoisotopic Mass | 270.23475 |
| SMILES | [H][C@@]1([C@@H](C)CCC=C(C)C)CC[C@@H](C)c2ccc(C)cc21 |
| InChI | InChI=1S/C20H30/c1-14(2)7-6-8-16(4)19-12-10-17(5)18-11-9-15(3)13-20(18)19/h7,9,11,13,16-17,19H,6,8,10,12H2,1-5H3/t16-,17+,19-/m0/s1 |
| InChIKey | JWQVCYABIGUFIY-SCTDSRPQSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serrulatane (CHEBI:228375) has role plant metabolite (CHEBI:76924) |
| serrulatane (CHEBI:228375) is a diterpene (CHEBI:35190) |
| serrulatane (CHEBI:228375) is a olefinic compound (CHEBI:78840) |
| serrulatane (CHEBI:228375) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| (1R,4S)-1,6-dimethyl-4-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene |
| Synonym | Source |
|---|---|
| serrulatene | ChEBI |
| Citations |
|---|