EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H33N7O |
| Net Charge | 0 |
| Average Mass | 543.675 |
| Monoisotopic Mass | 543.27466 |
| SMILES | Cc1ccc(Cn2ncc3nc(-c4ccc(N5CCN(C(=O)CCc6cnc7ccccc67)CC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C33H33N7O/c1-23-6-8-24(9-7-23)22-40-33-30(21-35-40)36-32(37-33)25-10-13-27(14-11-25)38-16-18-39(19-17-38)31(41)15-12-26-20-34-29-5-3-2-4-28(26)29/h2-11,13-14,20-21,34H,12,15-19,22H2,1H3,(H,36,37) |
| InChIKey | MCVSFHJAOXRNML-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Hedgehog signaling pathway inhibitor Any pathway inhibitor that inhibits the Hedgehog signalling pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| smoothib (CHEBI:228374) has role Hedgehog signaling pathway inhibitor (CHEBI:140921) |
| smoothib (CHEBI:228374) is a N-acylpiperazine (CHEBI:46844) |
| smoothib (CHEBI:228374) is a N-arylpiperazine (CHEBI:46848) |
| smoothib (CHEBI:228374) is a imidazopyrazole (CHEBI:192493) |
| smoothib (CHEBI:228374) is a indoles (CHEBI:24828) |
| smoothib (CHEBI:228374) is a tertiary carboxamide (CHEBI:140326) |
| smoothib (CHEBI:228374) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 3-(1H-indol-3-yl)-1-(4-{4-[1-(4-methylbenzyl)-1,6-dihydroimidazo[4,5-c]pyrazol-5-yl]phenyl}piperazin-1-yl)propan-1-one |
| Citations |
|---|