EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O6 |
| Net Charge | 0 |
| Average Mass | 204.178 |
| Monoisotopic Mass | 204.06339 |
| SMILES | COC1=C(O)[C@H](O)[C@](O)(CO)CC1=O |
| InChI | InChI=1S/C8H12O6/c1-14-6-4(10)2-8(13,3-9)7(12)5(6)11/h7,9,11-13H,2-3H2,1H3/t7-,8+/m0/s1 |
| InChIKey | KENOUOLPKKQXMX-JGVFFNPUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gadusol (CHEBI:228373) is a 3,5,6-Trihydroxy-5-(hydroxymethyl)-2-methoxy-2-cyclohexen-1-one (CHEBI:172445) |
| gadusol (CHEBI:228373) is conjugate acid of gadusol(1−) (CHEBI:228248) |
| Incoming Relation(s) |
| gadusol(1−) (CHEBI:228248) is conjugate base of gadusol (CHEBI:228373) |
| IUPAC Name |
|---|
| (4R,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one |
| Manual Xrefs | Databases |
|---|---|
| CPD-18772 | MetaCyc |