EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H47O9S.Na |
| Net Charge | 0 |
| Average Mass | 570.721 |
| Monoisotopic Mass | 570.28385 |
| SMILES | [H][C@]1([C@H](C)CCC[C@H](C)CO)[C@@H](O)[C@H](OS(=O)(=O)[O-])C2C3C[C@@H](O)[C@@]4(O)C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C.[Na+] |
| InChI | InChI=1S/C27H48O9S.Na/c1-15(14-28)6-5-7-16(2)21-23(31)24(36-37(33,34)35)22-18-12-20(30)27(32)13-17(29)8-11-26(27,4)19(18)9-10-25(21,22)3;/h15-24,28-32H,5-14H2,1-4H3,(H,33,34,35);/q;+1/p-1/t15-,16+,17-,18?,19?,20+,21-,22?,23+,24+,25+,26+,27-;/m0./s1 |
| InChIKey | PBROQOHDHUXSEC-FXJKTJHOSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosaster (ncbitaxon:556858) | Whole Organism (NCIT:C13413) | Article (Bruno I., Minale, L., and Riccio, R., and La Barre, S. & Laurent, D. (1990) Isolation and structure of new polyhydroxylated sterols from a deep-water starfish of the genus Rosaster. Gazzetta Chimica Italiana, 120, 449-451.) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium (9ξ,14ξ,25S)-3β,5,6β,16β,26-pentahydroxy-5α,8ξ-cholestan-15α-yl sulfate (CHEBI:228368) has role animal metabolite (CHEBI:75767) |
| sodium (9ξ,14ξ,25S)-3β,5,6β,16β,26-pentahydroxy-5α,8ξ-cholestan-15α-yl sulfate (CHEBI:228368) has role marine metabolite (CHEBI:76507) |
| sodium (9ξ,14ξ,25S)-3β,5,6β,16β,26-pentahydroxy-5α,8ξ-cholestan-15α-yl sulfate (CHEBI:228368) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (9ξ,14ξ,25S)-3β,5,6β,16β,26-pentahydroxy-5α,8ξ-cholestan-15α-yl sulfate |
| Synonym | Source |
|---|---|
| (25S)-5α-cholestane-3β,5α,6β,15α,16β,26-hexol 15-sulphate | ChEBI |