EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228366 - AT-1015 hydrochloride
| Formula | C29H33N3O2.HCl |
| Net Charge | 0 |
| Average Mass | 492.063 |
| Monoisotopic Mass | 491.23396 |
| SMILES | Cl.[H]C(=O)N1CCC(C(=O)NCCN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C29H33N3O2.ClH/c33-21-32-18-13-25(14-19-32)29(34)30-15-20-31-16-11-24(12-17-31)28-26-7-3-1-5-22(26)9-10-23-6-2-4-8-27(23)28;/h1-10,21,25H,11-20H2,(H,30,34);1H |
| InChIKey | YZHGXYNLMHGNJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AT-1015 hydrochloride (CHEBI:228366) has part AT-1015(1+) (CHEBI:234342) |
| AT-1015 hydrochloride (CHEBI:228366) has role platelet aggregation inhibitor (CHEBI:50427) |
| AT-1015 hydrochloride (CHEBI:228366) has role serotonergic antagonist (CHEBI:48279) |
| AT-1015 hydrochloride (CHEBI:228366) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| AT-1015 hydrochloride monohydrate (CHEBI:234343) has part AT-1015 hydrochloride (CHEBI:228366) |
| IUPAC Name |
|---|
| N-{2-[4-(5H-dibenzo[a,d][7]annulen-5-ylidene)piperidin-1-yl]ethyl}-1-formylpiperidine-4-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| AT1015 | ChEBI |
| AT 1015 | ChEBI |
| N-{2-[4-(5H-dibenzo[a,d][7]annulen-5-ylidene)piperidin-1-yl]ethyl}-1-formylpiperidine-4-carboxamide—hydrogen chloride | IUPAC |
| AT-1015 | ChEBI |
| AT1015 hydrochloride | ChEBI |
| AT-1015 HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:190508-50-0 | ChEBI |
| Citations |
|---|