EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30N2O6 |
| Net Charge | 0 |
| Average Mass | 490.556 |
| Monoisotopic Mass | 490.21039 |
| SMILES | CC[C@@H](Oc1cccc(CN(CCCOc2ccc(OC)cc2)c2nc3ccccc3o2)c1)C(=O)O |
| InChI | InChI=1S/C28H30N2O6/c1-3-25(27(31)32)35-23-9-6-8-20(18-23)19-30(28-29-24-10-4-5-11-26(24)36-28)16-7-17-34-22-14-12-21(33-2)13-15-22/h4-6,8-15,18,25H,3,7,16-17,19H2,1-2H3,(H,31,32)/t25-/m1/s1 |
| InChIKey | ZHKNLJLMDFQVHJ-RUZDIDTESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pemafibrate (CHEBI:228365) has role antilipemic drug (CHEBI:35679) |
| pemafibrate (CHEBI:228365) has role hepatoprotective agent (CHEBI:62868) |
| pemafibrate (CHEBI:228365) has role PPARα agonist (CHEBI:70782) |
| pemafibrate (CHEBI:228365) is a 1,3-benzoxazoles (CHEBI:51548) |
| pemafibrate (CHEBI:228365) is a aromatic amine (CHEBI:33860) |
| pemafibrate (CHEBI:228365) is a methoxybenzenes (CHEBI:51683) |
| pemafibrate (CHEBI:228365) is a monocarboxylic acid (CHEBI:25384) |
| pemafibrate (CHEBI:228365) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2R)-2-[3-({1,3-benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-[3-[[2-benzoxazolyl[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid | ChEBI |
| (R)-2-[3-[[N-(benzoxazol-2-yl)-N-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid | ChEBI |
| (R)-K 13675 | ChEBI |
| (R)-K-13675 | ChEBI |
| K 877 | ChEBI |
| K-877 | ChEBI |
| Brand Name | Source |
|---|---|
| Parmodia | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 9572605 | ChemSpider |
| D10711 | KEGG DRUG |
| DB15212 | DrugBank |
| HMDB0256213 | HMDB |
| P7F | PDBeChem |
| Pemafibrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:848259-27-8 | DrugBank |
| Citations |
|---|