EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30N2O6 |
| Net Charge | 0 |
| Average Mass | 490.556 |
| Monoisotopic Mass | 490.21039 |
| SMILES | CC[C@@H](Oc1cccc(CN(CCCOc2ccc(OC)cc2)c2nc3ccccc3o2)c1)C(=O)O |
| InChI | InChI=1S/C28H30N2O6/c1-3-25(27(31)32)35-23-9-6-8-20(18-23)19-30(28-29-24-10-4-5-11-26(24)36-28)16-7-17-34-22-14-12-21(33-2)13-15-22/h4-6,8-15,18,25H,3,7,16-17,19H2,1-2H3,(H,31,32)/t25-/m1/s1 |
| InChIKey | ZHKNLJLMDFQVHJ-RUZDIDTESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hepatoprotective agent Any compound that is able to prevent damage to the liver. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pemafibrate (CHEBI:228365) has role antilipemic drug (CHEBI:35679) |
| pemafibrate (CHEBI:228365) has role cardiovascular drug (CHEBI:35554) |
| pemafibrate (CHEBI:228365) has role hepatoprotective agent (CHEBI:62868) |
| pemafibrate (CHEBI:228365) has role PPARα agonist (CHEBI:70782) |
| pemafibrate (CHEBI:228365) is a 1,3-benzoxazoles (CHEBI:51548) |
| pemafibrate (CHEBI:228365) is a aromatic amine (CHEBI:33860) |
| pemafibrate (CHEBI:228365) is a methoxybenzenes (CHEBI:51683) |
| pemafibrate (CHEBI:228365) is a monocarboxylic acid (CHEBI:25384) |
| pemafibrate (CHEBI:228365) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2R)-2-[3-({1,3-benzoxazol-2-yl[3-(4-methoxyphenoxy)propyl]amino}methyl)phenoxy]butanoic acid |
| INN | Source |
|---|---|
| pemafibrato | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2R)-2-[3-[[2-benzoxazolyl[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid | ChEBI |
| (R)-2-[3-[[N-(benzoxazol-2-yl)-N-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid | ChEBI |
| (R)-K 13675 | ChEBI |
| (R)-K-13675 | ChEBI |
| K-13675, (r)- | ChEMBL |
| K 877 | ChEBI |
| Brand Name | Source |
|---|---|
| Parmodia | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 9572605 | ChemSpider |
| D10711 | KEGG DRUG |
| DB15212 | DrugBank |
| HMDB0256213 | HMDB |
| P7F | PDBeChem |
| Pemafibrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:848259-27-8 | DrugBank |
| Citations |
|---|