EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@]12CCC(C)=C[C@](C(C)C)(CC[C@H]1C)[C@@H]2O |
| InChI | InChI=1S/C15H26O/c1-10(2)15-8-7-12(4)13(14(15)16)6-5-11(3)9-15/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13+,14-,15+/m1/s1 |
| InChIKey | XHZXSPWRJOSMJL-BARDWOONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia maritima (ncbitaxon:669130) | - | PubMed (27273626) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| koidzumiol (CHEBI:228362) has role plant metabolite (CHEBI:76924) |
| koidzumiol (CHEBI:228362) is a carbobicyclic compound (CHEBI:36785) |
| koidzumiol (CHEBI:228362) is a sesquiterpenoid (CHEBI:26658) |
| koidzumiol (CHEBI:228362) is a tertiary allylic alcohol (CHEBI:134397) |
| IUPAC Name |
|---|
| (1R,6S,7R,10R)-3,7-dimethyl-1-(propan-2-yl)bicyclo[4.3.1]dec-2-en-10-ol |
| Citations |
|---|