EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=CC2=C(C(C)C)CC[C@H](C)C2CC1 |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,12,14H,5-8H2,1-4H3/t12-,14?/m0/s1 |
| InChIKey | FIAKMTRUEKZMNO-NBFOIZRFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daldinia eschscholtzii (ncbitaxon:292717) | - | PubMed (33959421) | Strain: MFLUCC 19-049 |
| Myrciaria floribunda (IPNI:599327-1) | leaf (BTO:0000713) | PubMed (37630195) | |
| Neomitranthes obscura (IPNI:961848-1) | leaf (BTO:0000713) | PubMed (36909200) | |
| Orthosiphon pallidus (IPNI:453550-1) | aerial part (BTO:0001658) | PubMed (30600707) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zonarene (CHEBI:228360) has role fungal metabolite (CHEBI:76946) |
| zonarene (CHEBI:228360) has role plant metabolite (CHEBI:76924) |
| zonarene (CHEBI:228360) has role volatile oil component (CHEBI:27311) |
| zonarene (CHEBI:228360) is a hexahydronaphthalenes (CHEBI:142348) |
| zonarene (CHEBI:228360) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S)-1,6-dimethyl-4-(propan-2-yl)-1,2,3,7,8,8a-hexahydronaphthalene |
| Manual Xrefs | Databases |
|---|---|
| C00032554 | KNApSAcK |
| FDB007234 | FooDB |
| HMDB0303004 | HMDB |
| Citations |
|---|