EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@]12CC=C(C)C=C1[C@]([H])([C@@H](C)CCC=C(C)C)CC[C@H]2C |
| InChI | InChI=1S/C20H32/c1-14(2)7-6-8-16(4)19-12-10-17(5)18-11-9-15(3)13-20(18)19/h7,9,13,16-19H,6,8,10-12H2,1-5H3/t16-,17+,18+,19-/m0/s1 |
| InChIKey | UHHDAYUUXQNIDH-MANSERQUSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroserrulatene (CHEBI:228352) has role plant metabolite (CHEBI:76924) |
| dihydroserrulatene (CHEBI:228352) is a diterpene (CHEBI:35190) |
| dihydroserrulatene (CHEBI:228352) is a hexahydronaphthalenes (CHEBI:142348) |
| dihydroserrulatene (CHEBI:228352) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (1S,4R,4aR)-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4,4a,5-hexahydronaphthalene |
| Citations |
|---|