EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NOS |
| Net Charge | 0 |
| Average Mass | 183.276 |
| Monoisotopic Mass | 183.07179 |
| SMILES | CNC[C@@H]1OCCc2ccsc21 |
| InChI | InChI=1S/C9H13NOS/c1-10-6-8-9-7(2-4-11-8)3-5-12-9/h3,5,8,10H,2,4,6H2,1H3/t8-/m0/s1 |
| InChIKey | ABDDQTDRAHXHOC-QMMMGPOBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. trace amine-associated receptor 1 agonist An agonist that selectively binds to and activates trace amine-associated receptor 1. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulotaront (CHEBI:228346) has role antidepressant (CHEBI:35469) |
| ulotaront (CHEBI:228346) has role antipsychotic agent (CHEBI:35476) |
| ulotaront (CHEBI:228346) has role psychotropic drug (CHEBI:35471) |
| ulotaront (CHEBI:228346) has role serotonergic agonist (CHEBI:35941) |
| ulotaront (CHEBI:228346) has role trace amine-associated receptor 1 agonist (CHEBI:228347) |
| ulotaront (CHEBI:228346) is a secondary amino compound (CHEBI:50995) |
| ulotaront (CHEBI:228346) is a thienopyran (CHEBI:48910) |
| IUPAC Name |
|---|
| 1-[(7S)-4,7-dihydro-5H-thieno[2,3-c]pyran-7-yl]-N-methylmethanamine |
| INNs | Source |
|---|---|
| ulotaront | WHO MedNet |
| ulotaront | WHO MedNet |
| ulotaront | WHO MedNet |
| ulotarontum | WHO MedNet |
| Synonyms | Source |
|---|---|
| SEP 363856 | ChEBI |
| SEP-363856 | DrugBank |
| SEP363856 | DrugBank |
| SEP-856 | DrugBank |
| Citations |
|---|