EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228346 - ulotaront
| Formula | C9H13NOS |
| Net Charge | 0 |
| Average Mass | 183.276 |
| Monoisotopic Mass | 183.07179 |
| SMILES | CNC[C@@H]1OCCc2ccsc21 |
| InChI | InChI=1S/C9H13NOS/c1-10-6-8-9-7(2-4-11-8)3-5-12-9/h3,5,8,10H,2,4,6H2,1H3/t8-/m0/s1 |
| InChIKey | ABDDQTDRAHXHOC-QMMMGPOBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. trace amine-associated receptor 1 agonist An agonist that selectively binds to and activates trace amine-associated receptor 1. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulotaront (CHEBI:228346) has role antidepressant (CHEBI:35469) |
| ulotaront (CHEBI:228346) has role antiparkinson drug (CHEBI:48407) |
| ulotaront (CHEBI:228346) has role antipsychotic agent (CHEBI:35476) |
| ulotaront (CHEBI:228346) has role anxiolytic drug (CHEBI:35474) |
| ulotaront (CHEBI:228346) has role psychotropic drug (CHEBI:35471) |
| ulotaront (CHEBI:228346) has role serotonergic agonist (CHEBI:35941) |
| ulotaront (CHEBI:228346) has role trace amine-associated receptor 1 agonist (CHEBI:228347) |
| ulotaront (CHEBI:228346) is a organic molecular entity (CHEBI:50860) |
| ulotaront (CHEBI:228346) is a secondary amino compound (CHEBI:50995) |
| ulotaront (CHEBI:228346) is a thienopyran (CHEBI:48910) |
| IUPAC Name |
|---|
| 1-[(7S)-4,7-dihydro-5H-thieno[2,3-c]pyran-7-yl]-N-methylmethanamine |
| INNs | Source |
|---|---|
| ulotaront | WHO MedNet |
| ulotaront | WHO MedNet |
| ulotaront | WHO MedNet |
| ulotarontum | WHO MedNet |
| Synonyms | Source |
|---|---|
| SEP 363856 | ChEBI |
| SEP-363856 | DrugBank |
| SEP363856 | DrugBank |
| SEP-856 | DrugBank |
| Citations |
|---|