EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O3 |
| Net Charge | 0 |
| Average Mass | 180.203 |
| Monoisotopic Mass | 180.07864 |
| SMILES | COc1c(C)cc(C(=O)O)cc1C |
| InChI | InChI=1S/C10H12O3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5H,1-3H3,(H,11,12) |
| InChIKey | WXVQURJGDUNJCS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-Dimethyl-4-methoxybenzoic acid (CHEBI:228339) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 4-methoxy-3,5-dimethylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 80256 | ChemSpider |