EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228306 - Dimethyl L-malate
| Formula | C6H10O5 |
| Net Charge | 0 |
| Average Mass | 162.141 |
| Monoisotopic Mass | 162.05282 |
| SMILES | COC(=O)C[C@H](O)C(=O)OC |
| InChI | InChI=1S/C6H10O5/c1-10-5(8)3-4(7)6(9)11-2/h4,7H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | YSEKNCXYRGKTBJ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dimethyl L-malate (CHEBI:228306) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| dimethyl (2S)-2-hydroxybutanedioate |
| Manual Xrefs | Databases |
|---|---|
| 8461284 | ChemSpider |