EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O4 |
| Net Charge | 0 |
| Average Mass | 356.462 |
| Monoisotopic Mass | 356.19876 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)CC=C1[C@@]3(C)C=CC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C22H28O4/c1-13-10-18-16-5-4-14-11-15(24)6-8-20(14,2)17(16)7-9-21(18,3)22(13,26)19(25)12-23/h6-8,11,13,16,18,23,26H,4-5,9-10,12H2,1-3H3/t13-,16-,18+,20+,21+,22+/m1/s1 |
| InChIKey | ZYTXTXAMMDTYDQ-DGEXFFLYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vamorolone (CHEBI:228304) has role anti-inflammatory drug (CHEBI:35472) |
| vamorolone (CHEBI:228304) has role glucocorticoid receptor agonist (CHEBI:63562) |
| vamorolone (CHEBI:228304) has role immunosuppressive agent (CHEBI:35705) |
| vamorolone (CHEBI:228304) is a 17α-hydroxy steroid (CHEBI:35342) |
| vamorolone (CHEBI:228304) is a 20-oxo steroid (CHEBI:36885) |
| vamorolone (CHEBI:228304) is a 21-hydroxy steroid (CHEBI:35344) |
| vamorolone (CHEBI:228304) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| vamorolone (CHEBI:228304) is a corticosteroid (CHEBI:50858) |
| vamorolone (CHEBI:228304) is a primary α-hydroxy ketone (CHEBI:139590) |
| vamorolone (CHEBI:228304) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 17,21-dihydroxy-16α-methylpregna-1,4,9(11)-triene-3,20-dione |
| INNs | Source |
|---|---|
| vamorolona | WHO MedNet |
| vamorolone | WHO MedNet |
| vamorolone | WHO MedNet |
| vamorolonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (16α)-17,21-dihydroxy-16-methylpregna-1,4,9(11)-triene-3,20-dione | ChEBI |
| 17α,21-dihydroxy-16α-methylpregna-1,4,9(11)-triene-3,20-dione | ChEBI |
| VBP 15 | ChEBI |
| VBP-15 | ChEBI |
| VBP15 | DrugBank |
| Brand Name | Source |
|---|---|
| Agamree | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11000 | KEGG DRUG |
| DB15114 | DrugBank |
| Vamorolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:13209-41-1 | KEGG DRUG |
| Citations |
|---|