EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O4 |
| Net Charge | 0 |
| Average Mass | 356.462 |
| Monoisotopic Mass | 356.19876 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)CC=C1[C@@]3(C)C=CC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C22H28O4/c1-13-10-18-16-5-4-14-11-15(24)6-8-20(14,2)17(16)7-9-21(18,3)22(13,26)19(25)12-23/h6-8,11,13,16,18,23,26H,4-5,9-10,12H2,1-3H3/t13-,16-,18+,20+,21+,22+/m1/s1 |
| InChIKey | ZYTXTXAMMDTYDQ-DGEXFFLYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vamorolone (CHEBI:228304) has role anti-inflammatory agent (CHEBI:67079) |
| vamorolone (CHEBI:228304) has role anti-inflammatory drug (CHEBI:35472) |
| vamorolone (CHEBI:228304) has role glucocorticoid receptor agonist (CHEBI:63562) |
| vamorolone (CHEBI:228304) has role immunosuppressive agent (CHEBI:35705) |
| vamorolone (CHEBI:228304) is a 17α-hydroxy steroid (CHEBI:35342) |
| vamorolone (CHEBI:228304) is a 20-oxo steroid (CHEBI:36885) |
| vamorolone (CHEBI:228304) is a 21-hydroxy steroid (CHEBI:35344) |
| vamorolone (CHEBI:228304) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| vamorolone (CHEBI:228304) is a corticosteroid (CHEBI:50858) |
| vamorolone (CHEBI:228304) is a primary α-hydroxy ketone (CHEBI:139590) |
| vamorolone (CHEBI:228304) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 17,21-dihydroxy-16α-methylpregna-1,4,9(11)-triene-3,20-dione |
| INNs | Source |
|---|---|
| vamorolona | WHO MedNet |
| vamorolone | WHO MedNet |
| vamorolone | WHO MedNet |
| vamorolonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (16α)-17,21-dihydroxy-16-methylpregna-1,4,9(11)-triene-3,20-dione | ChEBI |
| 17α,21-dihydroxy-16α-methylpregna-1,4,9(11)-triene-3,20-dione | ChEBI |
| 9,11-dehydro dexamethasone | ChEMBL |
| 9,11-dehydrodexamethasone acetate | ChEMBL |
| Vamorolone acetate | ChEMBL |
| VBP 15 | ChEBI |
| Brand Name | Source |
|---|---|
| Agamree | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11000 | KEGG DRUG |
| DB15114 | DrugBank |
| Vamorolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:13209-41-1 | KEGG DRUG |
| Citations |
|---|