EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O4 |
| Net Charge | 0 |
| Average Mass | 356.462 |
| Monoisotopic Mass | 356.19876 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)CC=C1[C@@]3(C)C=CC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C22H28O4/c1-13-10-18-16-5-4-14-11-15(24)6-8-20(14,2)17(16)7-9-21(18,3)22(13,26)19(25)12-23/h6-8,11,13,16,18,23,26H,4-5,9-10,12H2,1-3H3/t13-,16-,18+,20+,21+,22+/m1/s1 |
| InChIKey | ZYTXTXAMMDTYDQ-DGEXFFLYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-inflammatory drug A substance that reduces or suppresses inflammation. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vamorolone (CHEBI:228304) has role anti-inflammatory agent (CHEBI:67079) |
| vamorolone (CHEBI:228304) has role anti-inflammatory drug (CHEBI:35472) |
| vamorolone (CHEBI:228304) has role glucocorticoid receptor agonist (CHEBI:63562) |
| vamorolone (CHEBI:228304) has role immunosuppressive agent (CHEBI:35705) |
| vamorolone (CHEBI:228304) is a 17α-hydroxy steroid (CHEBI:35342) |
| vamorolone (CHEBI:228304) is a 20-oxo steroid (CHEBI:36885) |
| vamorolone (CHEBI:228304) is a 21-hydroxy steroid (CHEBI:35344) |
| vamorolone (CHEBI:228304) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| vamorolone (CHEBI:228304) is a corticosteroid (CHEBI:50858) |
| vamorolone (CHEBI:228304) is a primary α-hydroxy ketone (CHEBI:139590) |
| vamorolone (CHEBI:228304) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 17,21-dihydroxy-16α-methylpregna-1,4,9(11)-triene-3,20-dione |
| INNs | Source |
|---|---|
| vamorolona | WHO MedNet |
| vamorolone | WHO MedNet |
| vamorolone | WHO MedNet |
| vamorolonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (16α)-17,21-dihydroxy-16-methylpregna-1,4,9(11)-triene-3,20-dione | ChEBI |
| 17α,21-dihydroxy-16α-methylpregna-1,4,9(11)-triene-3,20-dione | ChEBI |
| 9,11-dehydro dexamethasone | ChEMBL |
| 9,11-dehydrodexamethasone acetate | ChEMBL |
| Vamorolone acetate | ChEMBL |
| VBP 15 | ChEBI |
| Brand Name | Source |
|---|---|
| Agamree | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11000 | KEGG DRUG |
| DB15114 | DrugBank |
| Vamorolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:13209-41-1 | KEGG DRUG |
| Citations |
|---|