EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35N3O2 |
| Net Charge | 0 |
| Average Mass | 409.574 |
| Monoisotopic Mass | 409.27293 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])C(=O)Cn3cc(C#N)cn3)[C@@]1([H])CC[C@@](C)(O)C2 |
| InChI | InChI=1S/C25H35N3O2/c1-24(30)9-7-18-17(11-24)3-4-20-19(18)8-10-25(2)21(20)5-6-22(25)23(29)15-28-14-16(12-26)13-27-28/h13-14,17-22,30H,3-11,15H2,1-2H3/t17-,18+,19-,20-,21+,22-,24-,25+/m1/s1 |
| InChIKey | HARRKNSQXBRBGZ-GVKWWOCJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zuranolone (CHEBI:228302) has role anticonvulsant (CHEBI:35623) |
| zuranolone (CHEBI:228302) has role antidepressant (CHEBI:35469) |
| zuranolone (CHEBI:228302) has role GABA modulator (CHEBI:50268) |
| zuranolone (CHEBI:228302) is a 20-oxo steroid (CHEBI:36885) |
| zuranolone (CHEBI:228302) is a 3-hydroxy steroid (CHEBI:36834) |
| zuranolone (CHEBI:228302) is a nitrile (CHEBI:18379) |
| zuranolone (CHEBI:228302) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 1-(3α-hydroxy-3β-methyl-20-oxo-5β-19-norpregnan-21-yl)-1H-pyrazole-4-carbonitrile |
| INNs | Source |
|---|---|
| zuranolone | WHO MedNet |
| zuranolone | WHO MedNet |
| zuranolone | WHO MedNet |
| zuranolonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[(3α,5β)-3-hydroxy-3-methyl-20-oxo-19-norpregnan-21-yl]-1H-pyrazole-4-carbonitrile | ChEBI |
| BIIB-125 | ChEBI |
| BIIB125 | ChEBI |
| S-812217 | ChEBI |
| SAGE 217 | DrugBank |
| SAGE-217 | DrugBank |
| Brand Name | Source |
|---|---|
| Zurzuvae | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11793 | KEGG DRUG |
| DB15490 | DrugBank |
| Zuranolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1632051-40-1 | ChEBI |
| Citations |
|---|