EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O7S |
| Net Charge | 0 |
| Average Mass | 524.720 |
| Monoisotopic Mass | 524.28077 |
| SMILES | [H][C@]12C[C@H](O)CC[C@]1(C)C1CC[C@@]3(C)C(CC[C@]3([H])[C@H](C)CCC(=C)C(C)COS(=O)(=O)O)C1=CC(=O)O2 |
| InChI | InChI=1S/C28H44O7S/c1-17(19(3)16-34-36(31,32)33)6-7-18(2)22-8-9-23-21-15-26(30)35-25-14-20(29)10-12-28(25,5)24(21)11-13-27(22,23)4/h15,18-20,22-25,29H,1,6-14,16H2,2-5H3,(H,31,32,33)/t18-,19?,20-,22-,23?,24?,25+,27-,28-/m1/s1 |
| InChIKey | UOWITEYXRONPSG-HRZHKYNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Asteriidae (ncbitaxon:7600) | - | DOI (10.1016/S0040-4020(97)00531-0) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asterasterol A (CHEBI:228299) has role animal metabolite (CHEBI:75767) |
| asterasterol A (CHEBI:228299) has role marine metabolite (CHEBI:76507) |
| asterasterol A (CHEBI:228299) is a 3α-hydroxy steroid (CHEBI:36835) |
| asterasterol A (CHEBI:228299) is a C28-steroid (CHEBI:188921) |
| asterasterol A (CHEBI:228299) is a oxa-steroid (CHEBI:50917) |
| asterasterol A (CHEBI:228299) is a steroid lactone (CHEBI:26766) |
| asterasterol A (CHEBI:228299) is a sulfooxy steroid (CHEBI:52035) |
| IUPAC Name |
|---|
| (6R)-6-[(3aS,5R,7aR,9aR,10R)-5-hydroxy-7a,9a-dimethyl-2-oxo-3a,4,5,6,7,7a,7b,8,9,9a,10,11,12,12a-tetradecahydro-2H-benzo[b]indeno[5,4-d]oxepin-10-yl]-2-methyl-3-methylideneheptyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 3α-hydroxy-24-methylene-26-sulphoxy-B-homo-5-oxa-5α-cholest-7-en-6-one | ChEBI |
| (+)-asterasterol A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:193008-25-2 | ChEBI |