EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228298 - 5α-cholesta-9(11)-en-3β, 20β-diol
| Formula | C27H46O2 |
| Net Charge | 0 |
| Average Mass | 402.663 |
| Monoisotopic Mass | 402.34978 |
| SMILES | CC(C)CCC[C@](C)(O)C1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C27H46O2/c1-18(2)7-6-14-27(5,29)24-11-10-22-21-9-8-19-17-20(28)12-15-25(19,3)23(21)13-16-26(22,24)4/h13,18-22,24,28-29H,6-12,14-17H2,1-5H3/t19?,20-,21?,22?,24?,25-,26-,27-/m0/s1 |
| InChIKey | DUSFFQDZSBTFKK-RSGHYBKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthaster planci (ncbitaxon:133434) | Whole body (BTO:0001489) | PubMed (34969331) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-cholesta-9(11)-en-3β, 20β-diol (CHEBI:228298) has role animal metabolite (CHEBI:75767) |
| 5α-cholesta-9(11)-en-3β, 20β-diol (CHEBI:228298) has role antibacterial agent (CHEBI:33282) |
| 5α-cholesta-9(11)-en-3β, 20β-diol (CHEBI:228298) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| 5α-cholesta-9(11)-en-3β, 20β-diol (CHEBI:228298) has role marine metabolite (CHEBI:76507) |
| 5α-cholesta-9(11)-en-3β, 20β-diol (CHEBI:228298) is a 20-hydroxy steroid (CHEBI:36854) |
| 5α-cholesta-9(11)-en-3β, 20β-diol (CHEBI:228298) is a 3β-hydroxy steroid (CHEBI:36836) |
| 5α-cholesta-9(11)-en-3β, 20β-diol (CHEBI:228298) is a C27-steroid (CHEBI:131619) |
| IUPAC Name |
|---|
| (14ξ)-8ξ,17ξ-cholest-9(11)-ene-3β,20-diol |
| Citations |
|---|