EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | CC(C)=CC(=O)C[C@](C)(O)C1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H44O3/c1-17(2)14-20(29)16-27(5,30)24-9-8-22-21-7-6-18-15-19(28)10-12-25(18,3)23(21)11-13-26(22,24)4/h14,18-19,21-24,28,30H,6-13,15-16H2,1-5H3/t18?,19-,21?,22?,23?,24?,25-,26-,27-/m0/s1 |
| InChIKey | JLSGWGFUNKKVBT-FMDNSJKISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthaster planci (ncbitaxon:133434) | Whole body (BTO:0001489) | PubMed (34969331) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) has role animal metabolite (CHEBI:75767) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) has role antibacterial agent (CHEBI:33282) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) has role marine metabolite (CHEBI:76507) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) is a 20-hydroxy steroid (CHEBI:36854) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) is a 23-oxo steroid (CHEBI:228297) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) is a 3β-hydroxy steroid (CHEBI:36836) |
| 5α-cholesta-24-en-3β,20β-diol-23-one (CHEBI:228296) is a C27-steroid (CHEBI:131619) |
| IUPAC Name |
|---|
| (9ξ,14ξ)-3β,20-dihydroxy-8ξ,17ξ-cholest-24-en-23-one |
| Citations |
|---|