EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O2 |
| Net Charge | 0 |
| Average Mass | 402.663 |
| Monoisotopic Mass | 402.34978 |
| SMILES | [H][C@]1([C@H](C)CCCC(C)C)CCC2C3=CCC4C[C@@H](O)CC[C@]4(C)[C@@]3(O)CC[C@@]21C |
| InChI | InChI=1S/C27H46O2/c1-18(2)7-6-8-19(3)22-11-12-23-24-10-9-20-17-21(28)13-14-26(20,5)27(24,29)16-15-25(22,23)4/h10,18-23,28-29H,6-9,11-17H2,1-5H3/t19-,20?,21+,22-,23?,25-,26+,27-/m1/s1 |
| InChIKey | JJJSDRCOEVDSMV-ASDXCJLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astropecten polyacanthus (ncbitaxon:60560) | - | PubMed (24088696) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astropectenol D (CHEBI:228293) has role animal metabolite (CHEBI:75767) |
| astropectenol D (CHEBI:228293) has role marine metabolite (CHEBI:76507) |
| astropectenol D (CHEBI:228293) is a 3β-hydroxy steroid (CHEBI:36836) |
| astropectenol D (CHEBI:228293) is a 9-hydroxy steroid (CHEBI:63644) |
| astropectenol D (CHEBI:228293) is a C27-steroid (CHEBI:131619) |
| IUPAC Name |
|---|
| (14ξ)-cholest-7-ene-3β,9-diol |
| Citations |
|---|