EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O3 |
| Net Charge | 0 |
| Average Mass | 418.662 |
| Monoisotopic Mass | 418.34470 |
| SMILES | [H]C(=O)C1C2C[C@@H](O)CC[C@]2(C)C2CC[C@@]3(C)C(CC[C@]3([H])[C@H](C)CCCC(C)C)[C@]12O |
| InChI | InChI=1S/C27H46O3/c1-17(2)7-6-8-18(3)20-9-10-23-25(20,4)14-12-24-26(5)13-11-19(29)15-21(26)22(16-28)27(23,24)30/h16-24,29-30H,6-15H2,1-5H3/t18-,19+,20-,21?,22?,23?,24?,25-,26+,27-/m1/s1 |
| InChIKey | XZVFKHAABZAWQF-UEJQZEMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astropecten polyacanthus (ncbitaxon:60560) | - | PubMed (24088696) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astropectenol A (CHEBI:228291) has role animal metabolite (CHEBI:75767) |
| astropectenol A (CHEBI:228291) has role marine metabolite (CHEBI:76507) |
| astropectenol A (CHEBI:228291) is a 3β-hydroxy steroid (CHEBI:36836) |
| astropectenol A (CHEBI:228291) is a C27-steroid (CHEBI:131619) |
| astropectenol A (CHEBI:228291) is a steroid aldehyde (CHEBI:131565) |
| IUPAC Name |
|---|
| (3R,3aR,5bS,8S,10aR)-8,10a-dihydroxy-3a,5b-dimethyl-3-[(2R)-6-methylheptan-2-yl]hexadecahydrocyclopenta[a]fluorene-10-carbaldehyde |
| Citations |
|---|